C13H17IO3 — CID 143499870
7-(iodomethyl)-5-(2-methoxyethoxy)-3,4-dihydro-2H-chromene (PubChem CID 143499870) has the molecular formula C13H17IO3 and a molecular weight of 348.18 g/mol. Its IUPAC name is 7-(iodomethyl)-5-(2-methoxyethoxy)-3,4-dihydro-2H-chromene.
| Compound Name | 7-(iodomethyl)-5-(2-methoxyethoxy)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 143499870 |
| Molecular Formula | C13H17IO3 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 7-(iodomethyl)-5-(2-methoxyethoxy)-3,4-dihydro-2H-chromene |
| SMILES | COCCOc1cc(CI)cc2c1CCCO2 |
| InChI | InChI=1S/C13H17IO3/c1-15-5-6-17-13-8-10(9-14)7-12-11(13)3-2-4-16-12/h7-8H,2-6,9H2,1H3 |
| InChIKey | GHACJLHJDJAQKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|