C12H17ClO4S — CID 117472732
(4,5-dimethoxy-2-propan-2-ylphenyl)methanesulfonyl chloride (PubChem CID 117472732) has the molecular formula C12H17ClO4S and a molecular weight of 292.78 g/mol. Its IUPAC name is (4,5-dimethoxy-2-propan-2-ylphenyl)methanesulfonyl chloride.
| Compound Name | (4,5-dimethoxy-2-propan-2-ylphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117472732 |
| Molecular Formula | C12H17ClO4S |
| Molecular Weight | 292.78 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (4,5-dimethoxy-2-propan-2-ylphenyl)methanesulfonyl chloride |
| SMILES | COc1cc(CS(=O)(=O)Cl)c(C(C)C)cc1OC |
| InChI | InChI=1S/C12H17ClO4S/c1-8(2)10-6-12(17-4)11(16-3)5-9(10)7-18(13,14)15/h5-6,8H,7H2,1-4H3 |
| InChIKey | ASIMXTNTJXJGRT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |