(2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride

C12H17ClO4S — CID 117472731

IUPAC(2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride
SMILESCOc1cc(OC)c(C(C)C)cc1CS(=O)(=O)Cl
InChIInChI=1S/C12H17ClO4S/c1-8(2)10-5-9(7-18(13,14)15)11(16-3)6-12(10)17-4/h5-6,8H,7H2,1-4H3
InChIKeyWPHTVSLVCBRLKT-UHFFFAOYSA-N
MW292.78 g/mol
LogP2.90
Rot. Bonds5

About (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride

(2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride (PubChem CID 117472731) has the molecular formula C12H17ClO4S and a molecular weight of 292.78 g/mol. Its IUPAC name is (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride.

Molecular Properties

Compound Name(2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride
PubChem CID117472731
Molecular FormulaC12H17ClO4S
Molecular Weight292.78 g/mol
Exact Mass292.05
IUPAC Name(2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride
SMILESCOc1cc(OC)c(C(C)C)cc1CS(=O)(=O)Cl
InChIInChI=1S/C12H17ClO4S/c1-8(2)10-5-9(7-18(13,14)15)11(16-3)6-12(10)17-4/h5-6,8H,7H2,1-4H3
InChIKeyWPHTVSLVCBRLKT-UHFFFAOYSA-N
XLogP2.90
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.78
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride?
The IUPAC name of (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride (CID 117472731) is (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride.
What is the SMILES notation for (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride?
The canonical SMILES for (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride is COc1cc(OC)c(C(C)C)cc1CS(=O)(=O)Cl.
What is the InChIKey of (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride?
The InChIKey is WPHTVSLVCBRLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClO4S/c1-8(2)10-5-9(7-18(13,14)15)11(16-3)6-12(10)17-4/h5-6,8H,7H2,1-4H3.
What are the key properties of (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride?
(2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride has a molecular weight of 292.78 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethoxy-5-propan-2-ylphenyl)methanesulfonyl chloride is sourced from PubChem (CID 117472731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).