[2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride

C11H15ClO5S — CID 117475353

IUPAC[2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride
SMILESCOCc1cc(OC)cc(CS(=O)(=O)Cl)c1OC
InChIInChI=1S/C11H15ClO5S/c1-15-6-8-4-10(16-2)5-9(11(8)17-3)7-18(12,13)14/h4-5H,6-7H2,1-3H3
InChIKeyYVOWSBWRLDJDGN-UHFFFAOYSA-N
MW294.76 g/mol
LogP1.92
Rot. Bonds6

About [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride

[2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride (PubChem CID 117475353) has the molecular formula C11H15ClO5S and a molecular weight of 294.76 g/mol. Its IUPAC name is [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride.

Molecular Properties

Compound Name[2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride
PubChem CID117475353
Molecular FormulaC11H15ClO5S
Molecular Weight294.76 g/mol
Exact Mass294.03
IUPAC Name[2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride
SMILESCOCc1cc(OC)cc(CS(=O)(=O)Cl)c1OC
InChIInChI=1S/C11H15ClO5S/c1-15-6-8-4-10(16-2)5-9(11(8)17-3)7-18(12,13)14/h4-5H,6-7H2,1-3H3
InChIKeyYVOWSBWRLDJDGN-UHFFFAOYSA-N
XLogP1.92
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.76
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride?
The IUPAC name of [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride (CID 117475353) is [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride.
What is the SMILES notation for [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride?
The canonical SMILES for [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride is COCc1cc(OC)cc(CS(=O)(=O)Cl)c1OC.
What is the InChIKey of [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride?
The InChIKey is YVOWSBWRLDJDGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO5S/c1-15-6-8-4-10(16-2)5-9(11(8)17-3)7-18(12,13)14/h4-5H,6-7H2,1-3H3.
What are the key properties of [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride?
[2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride has a molecular weight of 294.76 g/mol, XLogP of 1.92, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dimethoxy-3-(methoxymethyl)phenyl]methanesulfonyl chloride is sourced from PubChem (CID 117475353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).