4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid

C14H20O5 — CID 117424486

IUPAC4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid
SMILESCOCc1cc(OC)cc(CCCC(=O)O)c1OC
InChIInChI=1S/C14H20O5/c1-17-9-11-8-12(18-2)7-10(14(11)19-3)5-4-6-13(15)16/h7-8H,4-6,9H2,1-3H3,(H,15,16)
InChIKeyIYASXOASKBYNGE-UHFFFAOYSA-N
MW268.31 g/mol
LogP2.26
Rot. Bonds8

About 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid

4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid (PubChem CID 117424486) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid.

Molecular Properties

Compound Name4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid
PubChem CID117424486
Molecular FormulaC14H20O5
Molecular Weight268.31 g/mol
Exact Mass268.13
IUPAC Name4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid
SMILESCOCc1cc(OC)cc(CCCC(=O)O)c1OC
InChIInChI=1S/C14H20O5/c1-17-9-11-8-12(18-2)7-10(14(11)19-3)5-4-6-13(15)16/h7-8H,4-6,9H2,1-3H3,(H,15,16)
InChIKeyIYASXOASKBYNGE-UHFFFAOYSA-N
XLogP2.26
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid?
The IUPAC name of 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid (CID 117424486) is 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid.
What is the SMILES notation for 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid?
The canonical SMILES for 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid is COCc1cc(OC)cc(CCCC(=O)O)c1OC.
What is the InChIKey of 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid?
The InChIKey is IYASXOASKBYNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-17-9-11-8-12(18-2)7-10(14(11)19-3)5-4-6-13(15)16/h7-8H,4-6,9H2,1-3H3,(H,15,16).
What are the key properties of 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid?
4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid has a molecular weight of 268.31 g/mol, XLogP of 2.26, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid is sourced from PubChem (CID 117424486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).