C14H20O5 — CID 117424486
4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid (PubChem CID 117424486) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid.
| Compound Name | 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 117424486 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid |
| SMILES | COCc1cc(OC)cc(CCCC(=O)O)c1OC |
| InChI | InChI=1S/C14H20O5/c1-17-9-11-8-12(18-2)7-10(14(11)19-3)5-4-6-13(15)16/h7-8H,4-6,9H2,1-3H3,(H,15,16) |
| InChIKey | IYASXOASKBYNGE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |