2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid

C11H14O4 — CID 83884874

IUPAC2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid
SMILESCOCc1cccc(CC(=O)O)c1OC
InChIInChI=1S/C11H14O4/c1-14-7-9-5-3-4-8(6-10(12)13)11(9)15-2/h3-5H,6-7H2,1-2H3,(H,12,13)
InChIKeyUURBAOOJZRXFKX-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.47
Rot. Bonds5

About 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid

2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid (PubChem CID 83884874) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid.

Molecular Properties

Compound Name2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid
PubChem CID83884874
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Name2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid
SMILESCOCc1cccc(CC(=O)O)c1OC
InChIInChI=1S/C11H14O4/c1-14-7-9-5-3-4-8(6-10(12)13)11(9)15-2/h3-5H,6-7H2,1-2H3,(H,12,13)
InChIKeyUURBAOOJZRXFKX-UHFFFAOYSA-N
XLogP1.47
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(3-acetyl-2-methoxyphenyl)acetic acid
CID 175626652
2-(3-tert-butyl-2-methoxyphenyl)acetic acid
CID 21199434
1-[2-methoxy-3-(methoxymethyl)phenyl]cyclopentane-1-carboxylic acid
CID 117415224
1-(methoxymethyl)-2-[2-(methoxymethyl)-6-methylphenoxy]-3-methylbenzene
CID 70193365
(2-methoxy-3-methylphenyl)methyl hydrogen carbonate
CID 66777091
2-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]acetic acid
CID 13320599
4-[2,5-dimethoxy-3-(methoxymethyl)phenyl]butanoic acid
CID 117424486
2-[2,5-dimethoxy-4-(methoxymethyl)phenyl]acetic acid
CID 117353062
2-(6-methoxynaphthalen-1-yl)acetic acid
CID 10398394
3-[2-methoxy-3-(methoxymethyl)phenyl]-1,2-oxazole-5-carboxylic acid
CID 117411943
1-[3-(chloromethyl)-2-methoxyphenyl]propan-2-one
CID 118843525
4-[2-methoxy-6-(methoxymethyl)phenyl]butanoic acid
CID 115006348

Frequently Asked Questions

What is the IUPAC name of 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid?
The IUPAC name of 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid (CID 83884874) is 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid.
What is the SMILES notation for 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid?
The canonical SMILES for 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid is COCc1cccc(CC(=O)O)c1OC.
What is the InChIKey of 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid?
The InChIKey is UURBAOOJZRXFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-14-7-9-5-3-4-8(6-10(12)13)11(9)15-2/h3-5H,6-7H2,1-2H3,(H,12,13).
What are the key properties of 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid?
2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid has a molecular weight of 210.23 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methoxy-3-(methoxymethyl)phenyl]acetic acid is sourced from PubChem (CID 83884874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).