C16H27PS — CID 100974841
[2,4-ditert-butyl-6-(methylsulfanylmethyl)phenyl]phosphane (PubChem CID 100974841) has the molecular formula C16H27PS and a molecular weight of 282.43 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-(methylsulfanylmethyl)phenyl]phosphane.
| Compound Name | [2,4-ditert-butyl-6-(methylsulfanylmethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 100974841 |
| Molecular Formula | C16H27PS |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | [2,4-ditert-butyl-6-(methylsulfanylmethyl)phenyl]phosphane |
| SMILES | CSCc1cc(C(C)(C)C)cc(C(C)(C)C)c1P |
| InChI | InChI=1S/C16H27PS/c1-15(2,3)12-8-11(10-18-7)14(17)13(9-12)16(4,5)6/h8-9H,10,17H2,1-7H3 |
| InChIKey | ZZGZKUYITRHHBM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|