C15H25NO2 — CID 112513447
1-[2-(4-methoxy-2,3,5-trimethylphenyl)ethylamino]propan-2-ol (PubChem CID 112513447) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-[2-(4-methoxy-2,3,5-trimethylphenyl)ethylamino]propan-2-ol.
| Compound Name | 1-[2-(4-methoxy-2,3,5-trimethylphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 112513447 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-[2-(4-methoxy-2,3,5-trimethylphenyl)ethylamino]propan-2-ol |
| SMILES | COc1c(C)cc(CCNCC(C)O)c(C)c1C |
| InChI | InChI=1S/C15H25NO2/c1-10-8-14(6-7-16-9-11(2)17)12(3)13(4)15(10)18-5/h8,11,16-17H,6-7,9H2,1-5H3 |
| InChIKey | MHLBDJAMPARODD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|