C15H23NO3 — CID 112514975
2-(4-methoxy-2,3,5-trimethylphenyl)ethyl 2-aminopropanoate (PubChem CID 112514975) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-(4-methoxy-2,3,5-trimethylphenyl)ethyl 2-aminopropanoate.
| Compound Name | 2-(4-methoxy-2,3,5-trimethylphenyl)ethyl 2-aminopropanoate |
|---|---|
| PubChem CID | 112514975 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-(4-methoxy-2,3,5-trimethylphenyl)ethyl 2-aminopropanoate |
| SMILES | COc1c(C)cc(CCOC(=O)C(C)N)c(C)c1C |
| InChI | InChI=1S/C15H23NO3/c1-9-8-13(6-7-19-15(17)12(4)16)10(2)11(3)14(9)18-5/h8,12H,6-7,16H2,1-5H3 |
| InChIKey | VWPZSFQWZLGFGP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |