(4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid

C12H17NO3 — CID 115170855

IUPAC(4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid
SMILESCOc1c(C)cc(CNC(=O)O)c(C)c1C
InChIInChI=1S/C12H17NO3/c1-7-5-10(6-13-12(14)15)8(2)9(3)11(7)16-4/h5,13H,6H2,1-4H3,(H,14,15)
InChIKeyBYJBIZURFLOKGP-UHFFFAOYSA-N
MW223.27 g/mol
LogP2.39
Rot. Bonds3

About (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid

(4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid (PubChem CID 115170855) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid.

Molecular Properties

Compound Name(4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid
PubChem CID115170855
Molecular FormulaC12H17NO3
Molecular Weight223.27 g/mol
Exact Mass223.12
IUPAC Name(4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid
SMILESCOc1c(C)cc(CNC(=O)O)c(C)c1C
InChIInChI=1S/C12H17NO3/c1-7-5-10(6-13-12(14)15)8(2)9(3)11(7)16-4/h5,13H,6H2,1-4H3,(H,14,15)
InChIKeyBYJBIZURFLOKGP-UHFFFAOYSA-N
XLogP2.39
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.27
LogP ≤ 52.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid?
The IUPAC name of (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid (CID 115170855) is (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid.
What is the SMILES notation for (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid?
The canonical SMILES for (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid is COc1c(C)cc(CNC(=O)O)c(C)c1C.
What is the InChIKey of (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid?
The InChIKey is BYJBIZURFLOKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-7-5-10(6-13-12(14)15)8(2)9(3)11(7)16-4/h5,13H,6H2,1-4H3,(H,14,15).
What are the key properties of (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid?
(4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid has a molecular weight of 223.27 g/mol, XLogP of 2.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid is sourced from PubChem (CID 115170855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).