C12H17NO3 — CID 115170855
(4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid (PubChem CID 115170855) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid.
| Compound Name | (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 115170855 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (4-methoxy-2,3,5-trimethylphenyl)methylcarbamic acid |
| SMILES | COc1c(C)cc(CNC(=O)O)c(C)c1C |
| InChI | InChI=1S/C12H17NO3/c1-7-5-10(6-13-12(14)15)8(2)9(3)11(7)16-4/h5,13H,6H2,1-4H3,(H,14,15) |
| InChIKey | BYJBIZURFLOKGP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |