C11H17BrN2O — CID 115226195
N'-[2-(5-bromo-2-methoxyphenyl)ethyl]-N'-methylmethanediamine (PubChem CID 115226195) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is N'-[2-(5-bromo-2-methoxyphenyl)ethyl]-N'-methylmethanediamine.
| Compound Name | N'-[2-(5-bromo-2-methoxyphenyl)ethyl]-N'-methylmethanediamine |
|---|---|
| PubChem CID | 115226195 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N'-[2-(5-bromo-2-methoxyphenyl)ethyl]-N'-methylmethanediamine |
| SMILES | COc1ccc(Br)cc1CCN(C)CN |
| InChI | InChI=1S/C11H17BrN2O/c1-14(8-13)6-5-9-7-10(12)3-4-11(9)15-2/h3-4,7H,5-6,8,13H2,1-2H3 |
| InChIKey | WZRMLKYGHVTDTM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|