C12H17BrN2O2 — CID 115260219
2-[2-(5-bromo-2-methoxyphenyl)ethyl-methylamino]acetamide (PubChem CID 115260219) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-methoxyphenyl)ethyl-methylamino]acetamide.
| Compound Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl-methylamino]acetamide |
|---|---|
| PubChem CID | 115260219 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[2-(5-bromo-2-methoxyphenyl)ethyl-methylamino]acetamide |
| SMILES | COc1ccc(Br)cc1CCN(C)CC(N)=O |
| InChI | InChI=1S/C12H17BrN2O2/c1-15(8-12(14)16)6-5-9-7-10(13)3-4-11(9)17-2/h3-4,7H,5-6,8H2,1-2H3,(H2,14,16) |
| InChIKey | YXAKLBGVQOWUKN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |