C16H24Br2 — CID 79452952
2-[2,2-bis(bromomethyl)-4-methylpentyl]-1,4-dimethylbenzene (PubChem CID 79452952) has the molecular formula C16H24Br2 and a molecular weight of 376.18 g/mol. Its IUPAC name is 2-[2,2-bis(bromomethyl)-4-methylpentyl]-1,4-dimethylbenzene.
| Compound Name | 2-[2,2-bis(bromomethyl)-4-methylpentyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 79452952 |
| Molecular Formula | C16H24Br2 |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-[2,2-bis(bromomethyl)-4-methylpentyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(CC(CBr)(CBr)CC(C)C)c1 |
| InChI | InChI=1S/C16H24Br2/c1-12(2)8-16(10-17,11-18)9-15-7-13(3)5-6-14(15)4/h5-7,12H,8-11H2,1-4H3 |
| InChIKey | UHHIXQHTHVHSQZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|