C13H20BrN — CID 83187879
4-bromo-N-[(2,5-dimethylphenyl)methyl]butan-2-amine (PubChem CID 83187879) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 4-bromo-N-[(2,5-dimethylphenyl)methyl]butan-2-amine.
| Compound Name | 4-bromo-N-[(2,5-dimethylphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 83187879 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-bromo-N-[(2,5-dimethylphenyl)methyl]butan-2-amine |
| SMILES | Cc1ccc(C)c(CNC(C)CCBr)c1 |
| InChI | InChI=1S/C13H20BrN/c1-10-4-5-11(2)13(8-10)9-15-12(3)6-7-14/h4-5,8,12,15H,6-7,9H2,1-3H3 |
| InChIKey | KMVALCDHQKZULV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|