C13H21N — CID 93116797
(2S)-N-[(2,5-dimethylphenyl)methyl]butan-2-amine (PubChem CID 93116797) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2S)-N-[(2,5-dimethylphenyl)methyl]butan-2-amine.
| Compound Name | (2S)-N-[(2,5-dimethylphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 93116797 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2S)-N-[(2,5-dimethylphenyl)methyl]butan-2-amine |
| SMILES | CC[C@H](C)NCc1cc(C)ccc1C |
| InChI | InChI=1S/C13H21N/c1-5-12(4)14-9-13-8-10(2)6-7-11(13)3/h6-8,12,14H,5,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | UOPQKOGFEHHUSX-LBPRGKRZSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |