C12H17F2N — CID 43659052
1-(2,3-difluorophenyl)-4-methylpentan-3-amine (PubChem CID 43659052) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-4-methylpentan-3-amine.
| Compound Name | 1-(2,3-difluorophenyl)-4-methylpentan-3-amine |
|---|---|
| PubChem CID | 43659052 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(2,3-difluorophenyl)-4-methylpentan-3-amine |
| SMILES | CC(C)C(N)CCc1cccc(F)c1F |
| InChI | InChI=1S/C12H17F2N/c1-8(2)11(15)7-6-9-4-3-5-10(13)12(9)14/h3-5,8,11H,6-7,15H2,1-2H3 |
| InChIKey | WFCGVFXXSMFXTN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |