C11H15F2NO2 — CID 79493337
3-(2,3-difluorophenyl)-1,1-dimethoxypropan-2-amine (PubChem CID 79493337) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-1,1-dimethoxypropan-2-amine.
| Compound Name | 3-(2,3-difluorophenyl)-1,1-dimethoxypropan-2-amine |
|---|---|
| PubChem CID | 79493337 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-(2,3-difluorophenyl)-1,1-dimethoxypropan-2-amine |
| SMILES | COC(OC)C(N)Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H15F2NO2/c1-15-11(16-2)9(14)6-7-4-3-5-8(12)10(7)13/h3-5,9,11H,6,14H2,1-2H3 |
| InChIKey | IGJFHALIBCHTMG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|