C9H9BrF2 — CID 53433974
1-(3-bromopropyl)-2,3-difluorobenzene (PubChem CID 53433974) has the molecular formula C9H9BrF2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 1-(3-bromopropyl)-2,3-difluorobenzene.
| Compound Name | 1-(3-bromopropyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 53433974 |
| Molecular Formula | C9H9BrF2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 1-(3-bromopropyl)-2,3-difluorobenzene |
| SMILES | Fc1cccc(CCCBr)c1F |
| InChI | InChI=1S/C9H9BrF2/c10-6-2-4-7-3-1-5-8(11)9(7)12/h1,3,5H,2,4,6H2 |
| InChIKey | VSTFERLXUSIRBJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|