C10H13Br2N — CID 130665631
(2S)-4-(2,3-dibromophenyl)butan-2-amine (PubChem CID 130665631) has the molecular formula C10H13Br2N and a molecular weight of 307.03 g/mol. Its IUPAC name is (2S)-4-(2,3-dibromophenyl)butan-2-amine.
| Compound Name | (2S)-4-(2,3-dibromophenyl)butan-2-amine |
|---|---|
| PubChem CID | 130665631 |
| Molecular Formula | C10H13Br2N |
| Molecular Weight | 307.03 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | (2S)-4-(2,3-dibromophenyl)butan-2-amine |
| SMILES | C[C@H](N)CCc1cccc(Br)c1Br |
| InChI | InChI=1S/C10H13Br2N/c1-7(13)5-6-8-3-2-4-9(11)10(8)12/h2-4,7H,5-6,13H2,1H3/t7-/m0/s1 |
| InChIKey | IDFSLKBYVFRNPN-ZETCQYMHSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.03 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |