C9H11F2NO — CID 62343610
2-[(2,3-difluorophenyl)methoxy]ethanamine (PubChem CID 62343610) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methoxy]ethanamine.
| Compound Name | 2-[(2,3-difluorophenyl)methoxy]ethanamine |
|---|---|
| PubChem CID | 62343610 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methoxy]ethanamine |
| SMILES | NCCOCc1cccc(F)c1F |
| InChI | InChI=1S/C9H11F2NO/c10-8-3-1-2-7(9(8)11)6-13-5-4-12/h1-3H,4-6,12H2 |
| InChIKey | QDWADMXKJXOSJD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|