C20H11F5O2 — CID 175931362
3-ethoxy-4,6-difluoro-7-(3,4,5-trifluorophenyl)dibenzofuran (PubChem CID 175931362) has the molecular formula C20H11F5O2 and a molecular weight of 378.30 g/mol. Its IUPAC name is 3-ethoxy-4,6-difluoro-7-(3,4,5-trifluorophenyl)dibenzofuran.
| Compound Name | 3-ethoxy-4,6-difluoro-7-(3,4,5-trifluorophenyl)dibenzofuran |
|---|---|
| PubChem CID | 175931362 |
| Molecular Formula | C20H11F5O2 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 3-ethoxy-4,6-difluoro-7-(3,4,5-trifluorophenyl)dibenzofuran |
| SMILES | CCOc1ccc2c(oc3c(F)c(-c4cc(F)c(F)c(F)c4)ccc32)c1F |
| InChI | InChI=1S/C20H11F5O2/c1-2-26-15-6-5-12-11-4-3-10(9-7-13(21)17(24)14(22)8-9)16(23)19(11)27-20(12)18(15)25/h3-8H,2H2,1H3 |
| InChIKey | PCYXRBLLPHWCPA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|