C60H62F6O7 — CID 159114870
3-but-2-ynoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzofuran;bis(4,6-difluoro-3-methyl-7-(4-methylpentoxy)dibenzofuran) (PubChem CID 159114870) has the molecular formula C60H62F6O7 and a molecular weight of 1009.14 g/mol. Its IUPAC name is 3-but-2-ynoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzofuran;bis(4,6-difluoro-3-methyl-7-(4-methylpentoxy)dibenzofuran).
| Compound Name | 3-but-2-ynoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzofuran;bis(4,6-difluoro-3-methyl-7-(4-methylpentoxy)dibenzofuran) |
|---|---|
| PubChem CID | 159114870 |
| Molecular Formula | C60H62F6O7 |
| Molecular Weight | 1009.14 g/mol |
| Exact Mass | 1008.44 |
| IUPAC Name | 3-but-2-ynoxy-4,6-difluoro-7-(4-methylpentoxy)dibenzofuran;bis(4,6-difluoro-3-methyl-7-(4-methylpentoxy)dibenzofuran) |
| SMILES | CC#CCOc1ccc2c(oc3c(F)c(OCCCC(C)C)ccc32)c1F.Cc1ccc2c(oc3c(F)c(OCCCC(C)C)ccc32)c1F.Cc1ccc2c(oc3c(F)c(OCCCC(C)C)ccc32)c1F |
| InChI | InChI=1S/C22H22F2O3.2C19H20F2O2/c1-4-5-12-25-17-10-8-15-16-9-11-18(26-13-6-7-14(2)3)20(24)22(16)27-21(15)19(17)23;2*1-11(2)5-4-10-22-15-9-8-14-13-7-6-12(3)16(20)18(13)23-19(14)17(15)21/h8-11,14H,6-7,12-13H2,1-3H3;2*6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | KEYOGDMBLINXMO-UHFFFAOYSA-N |
| XLogP | 18.06 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.14 |
| LogP ≤ 5 | 18.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|