C26H33FO5 — CID 15065662
[(2R)-butan-2-yl] 2-fluoro-4-(4-octoxybenzoyl)oxybenzoate (PubChem CID 15065662) has the molecular formula C26H33FO5 and a molecular weight of 444.54 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-fluoro-4-(4-octoxybenzoyl)oxybenzoate.
| Compound Name | [(2R)-butan-2-yl] 2-fluoro-4-(4-octoxybenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 15065662 |
| Molecular Formula | C26H33FO5 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [(2R)-butan-2-yl] 2-fluoro-4-(4-octoxybenzoyl)oxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)O[C@H](C)CC)c(F)c2)cc1 |
| InChI | InChI=1S/C26H33FO5/c1-4-6-7-8-9-10-17-30-21-13-11-20(12-14-21)25(28)32-22-15-16-23(24(27)18-22)26(29)31-19(3)5-2/h11-16,18-19H,4-10,17H2,1-3H3/t19-/m1/s1 |
| InChIKey | VKXKSMHFCBOLIO-LJQANCHMSA-N |
| XLogP | 6.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|