C44H56N2O9 — CID 132540686
[4-[(2R)-1-hexoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-[[2,6-dimethyl-4-(10-prop-2-enoyloxydecoxy)phenyl]diazenyl]benzoate (PubChem CID 132540686) has the molecular formula C44H56N2O9 and a molecular weight of 756.94 g/mol. Its IUPAC name is [4-[(2R)-1-hexoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-[[2,6-dimethyl-4-(10-prop-2-enoyloxydecoxy)phenyl]diazenyl]benzoate.
| Compound Name | [4-[(2R)-1-hexoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-[[2,6-dimethyl-4-(10-prop-2-enoyloxydecoxy)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 132540686 |
| Molecular Formula | C44H56N2O9 |
| Molecular Weight | 756.94 g/mol |
| Exact Mass | 756.40 |
| IUPAC Name | [4-[(2R)-1-hexoxy-1-oxopropan-2-yl]oxycarbonylphenyl] 4-[[2,6-dimethyl-4-(10-prop-2-enoyloxydecoxy)phenyl]diazenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCCCCCOc1cc(C)c(/N=N/c2ccc(C(=O)Oc3ccc(C(=O)O[C@H](C)C(=O)OCCCCCC)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C44H56N2O9/c1-6-8-9-16-29-53-42(48)34(5)54-43(49)36-21-25-38(26-22-36)55-44(50)35-19-23-37(24-20-35)45-46-41-32(3)30-39(31-33(41)4)51-27-17-14-12-10-11-13-15-18-28-52-40(47)7-2/h7,19-26,30-31,34H,2,6,8-18,27-29H2,1,3-5H3/b46-45+/t34-/m1/s1 |
| InChIKey | HZQUCFAKFDKGMI-QCHFAUGWSA-N |
| XLogP | 10.84 |
| TPSA | 139.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.94 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|