C24H33NO5 — CID 70363882
4-methoxyaniline;4-[6-(2-methylprop-2-enoxy)hexoxy]benzoic acid (PubChem CID 70363882) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is 4-methoxyaniline;4-[6-(2-methylprop-2-enoxy)hexoxy]benzoic acid.
| Compound Name | 4-methoxyaniline;4-[6-(2-methylprop-2-enoxy)hexoxy]benzoic acid |
|---|---|
| PubChem CID | 70363882 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 4-methoxyaniline;4-[6-(2-methylprop-2-enoxy)hexoxy]benzoic acid |
| SMILES | C=C(C)COCCCCCCOc1ccc(C(=O)O)cc1.COc1ccc(N)cc1 |
| InChI | InChI=1S/C17H24O4.C7H9NO/c1-14(2)13-20-11-5-3-4-6-12-21-16-9-7-15(8-10-16)17(18)19;1-9-7-4-2-6(8)3-5-7/h7-10H,1,3-6,11-13H2,2H3,(H,18,19);2-5H,8H2,1H3 |
| InChIKey | IKKUCDCJCLMXQG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|