C25H34ClNO4 — CID 70363906
4-chloroaniline;4-[8-(2-methylprop-2-enoxy)octoxy]benzoic acid (PubChem CID 70363906) has the molecular formula C25H34ClNO4 and a molecular weight of 448.00 g/mol. Its IUPAC name is 4-chloroaniline;4-[8-(2-methylprop-2-enoxy)octoxy]benzoic acid.
| Compound Name | 4-chloroaniline;4-[8-(2-methylprop-2-enoxy)octoxy]benzoic acid |
|---|---|
| PubChem CID | 70363906 |
| Molecular Formula | C25H34ClNO4 |
| Molecular Weight | 448.00 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-chloroaniline;4-[8-(2-methylprop-2-enoxy)octoxy]benzoic acid |
| SMILES | C=C(C)COCCCCCCCCOc1ccc(C(=O)O)cc1.Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H28O4.C6H6ClN/c1-16(2)15-22-13-7-5-3-4-6-8-14-23-18-11-9-17(10-12-18)19(20)21;7-5-1-3-6(8)4-2-5/h9-12H,1,3-8,13-15H2,2H3,(H,20,21);1-4H,8H2 |
| InChIKey | CYYRKYWBVNYIJE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.00 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|