C25H35NO8 — CID 118331489
5-[[2-hydroxy-3-[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]propoxy]carbonylamino]pentyl 2-methylprop-2-enoate (PubChem CID 118331489) has the molecular formula C25H35NO8 and a molecular weight of 477.55 g/mol. Its IUPAC name is 5-[[2-hydroxy-3-[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]propoxy]carbonylamino]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[[2-hydroxy-3-[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]propoxy]carbonylamino]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118331489 |
| Molecular Formula | C25H35NO8 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 5-[[2-hydroxy-3-[4-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]propoxy]carbonylamino]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCNC(=O)OCC(O)COc1ccc(CCOC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C25H35NO8/c1-18(2)23(28)31-14-7-5-6-13-26-25(30)34-17-21(27)16-33-22-10-8-20(9-11-22)12-15-32-24(29)19(3)4/h8-11,21,27H,1,3,5-7,12-17H2,2,4H3,(H,26,30) |
| InChIKey | HNSPVUNUNKZVFK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|