C37H46O10 — CID 134236325
1-O-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-4-oxobutanoyl]oxyethyl]phenyl] 4-O-(2,3,4,5-tetramethylphenyl) cyclohexane-1,4-dicarboxylate (PubChem CID 134236325) has the molecular formula C37H46O10 and a molecular weight of 650.76 g/mol. Its IUPAC name is 1-O-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-4-oxobutanoyl]oxyethyl]phenyl] 4-O-(2,3,4,5-tetramethylphenyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-4-oxobutanoyl]oxyethyl]phenyl] 4-O-(2,3,4,5-tetramethylphenyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134236325 |
| Molecular Formula | C37H46O10 |
| Molecular Weight | 650.76 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 1-O-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)propoxy]-4-oxobutanoyl]oxyethyl]phenyl] 4-O-(2,3,4,5-tetramethylphenyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(C)COC(=O)CCC(=O)OCCc1ccc(OC(=O)C2CCC(C(=O)Oc3cc(C)c(C)c(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C37H46O10/c1-22(2)35(40)45-24(4)21-44-34(39)17-16-33(38)43-19-18-28-8-14-31(15-9-28)46-36(41)29-10-12-30(13-11-29)37(42)47-32-20-23(3)25(5)26(6)27(32)7/h8-9,14-15,20,24,29-30H,1,10-13,16-19,21H2,2-7H3 |
| InChIKey | DFTHLQUPCOZSHG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.76 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|