C36H44O10S2 — CID 146370193
4-O-[4,5-dimethyl-2,3-bis(sulfanyl)phenyl] 1-O-[4-[2-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 146370193) has the molecular formula C36H44O10S2 and a molecular weight of 700.87 g/mol. Its IUPAC name is 4-O-[4,5-dimethyl-2,3-bis(sulfanyl)phenyl] 1-O-[4-[2-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4,5-dimethyl-2,3-bis(sulfanyl)phenyl] 1-O-[4-[2-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 146370193 |
| Molecular Formula | C36H44O10S2 |
| Molecular Weight | 700.87 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | 4-O-[4,5-dimethyl-2,3-bis(sulfanyl)phenyl] 1-O-[4-[2-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxyethyl]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCC(C)(C)COC(=O)CCC(=O)OCCc1ccc(OC(=O)C2CCC(C(=O)Oc3cc(C)c(C)c(S)c3S)CC2)cc1 |
| InChI | InChI=1S/C36H44O10S2/c1-6-29(37)43-20-36(4,5)21-44-31(39)16-15-30(38)42-18-17-24-7-13-27(14-8-24)45-34(40)25-9-11-26(12-10-25)35(41)46-28-19-22(2)23(3)32(47)33(28)48/h6-8,13-14,19,25-26,47-48H,1,9-12,15-18,20-21H2,2-5H3 |
| InChIKey | SNDMKJKRIGHTPT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.87 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|