C32H49ClO4 — CID 155716279
[3-chloro-4-(6-methoxyhexyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate;prop-2-enal (PubChem CID 155716279) has the molecular formula C32H49ClO4 and a molecular weight of 533.19 g/mol. Its IUPAC name is [3-chloro-4-(6-methoxyhexyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate;prop-2-enal.
| Compound Name | [3-chloro-4-(6-methoxyhexyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate;prop-2-enal |
|---|---|
| PubChem CID | 155716279 |
| Molecular Formula | C32H49ClO4 |
| Molecular Weight | 533.19 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | [3-chloro-4-(6-methoxyhexyl)phenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate;prop-2-enal |
| SMILES | C=CC=O.CCCC1CCC(C2CCC(C(=O)Oc3ccc(CCCCCCOC)c(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C29H45ClO3.C3H4O/c1-3-8-22-10-12-23(13-11-22)24-14-16-26(17-15-24)29(31)33-27-19-18-25(28(30)21-27)9-6-4-5-7-20-32-2;1-2-3-4/h18-19,21-24,26H,3-17,20H2,1-2H3;2-3H,1H2 |
| InChIKey | XXOVOAMMOUCABR-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.19 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|