C29H30O12 — CID 54411581
2-[4-[2-methoxy-1-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenyl]-2-oxoethyl]phenoxy]carbonyloxyethyl 2-methylprop-2-enoate (PubChem CID 54411581) has the molecular formula C29H30O12 and a molecular weight of 570.55 g/mol. Its IUPAC name is 2-[4-[2-methoxy-1-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenyl]-2-oxoethyl]phenoxy]carbonyloxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-methoxy-1-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenyl]-2-oxoethyl]phenoxy]carbonyloxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54411581 |
| Molecular Formula | C29H30O12 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 2-[4-[2-methoxy-1-[4-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyloxy]phenyl]-2-oxoethyl]phenoxy]carbonyloxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)Oc1ccc(C(C(=O)OC)c2ccc(OC(=O)OCCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C29H30O12/c1-18(2)25(30)36-14-16-38-28(33)40-22-10-6-20(7-11-22)24(27(32)35-5)21-8-12-23(13-9-21)41-29(34)39-17-15-37-26(31)19(3)4/h6-13,24H,1,3,14-17H2,2,4-5H3 |
| InChIKey | VUMZJKYNBMILFH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|