C24H39NO4 — CID 156746845
ethane;2-[[4-(2,4,5-trimethylhexan-3-yl)phenyl]carbamoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 156746845) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is ethane;2-[[4-(2,4,5-trimethylhexan-3-yl)phenyl]carbamoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | ethane;2-[[4-(2,4,5-trimethylhexan-3-yl)phenyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156746845 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | ethane;2-[[4-(2,4,5-trimethylhexan-3-yl)phenyl]carbamoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)Nc1ccc(C(C(C)C)C(C)C(C)C)cc1.CC |
| InChI | InChI=1S/C22H33NO4.C2H6/c1-14(2)17(7)20(15(3)4)18-8-10-19(11-9-18)23-22(25)27-13-12-26-21(24)16(5)6;1-2/h8-11,14-15,17,20H,5,12-13H2,1-4,6-7H3,(H,23,25);1-2H3 |
| InChIKey | LFPAYXYVWAYDFJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|