C46H54Cl2O13 — CID 161244328
bis(3-butanoyl-4-hydroxyphenyl) cyclohexane-1,4-dicarboxylate;cyclohexane-1,4-dicarbonyl chloride;1-(2,5-dihydroxyphenyl)butan-1-one (PubChem CID 161244328) has the molecular formula C46H54Cl2O13 and a molecular weight of 885.83 g/mol. Its IUPAC name is bis(3-butanoyl-4-hydroxyphenyl) cyclohexane-1,4-dicarboxylate;cyclohexane-1,4-dicarbonyl chloride;1-(2,5-dihydroxyphenyl)butan-1-one.
| Compound Name | bis(3-butanoyl-4-hydroxyphenyl) cyclohexane-1,4-dicarboxylate;cyclohexane-1,4-dicarbonyl chloride;1-(2,5-dihydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 161244328 |
| Molecular Formula | C46H54Cl2O13 |
| Molecular Weight | 885.83 g/mol |
| Exact Mass | 884.29 |
| IUPAC Name | bis(3-butanoyl-4-hydroxyphenyl) cyclohexane-1,4-dicarboxylate;cyclohexane-1,4-dicarbonyl chloride;1-(2,5-dihydroxyphenyl)butan-1-one |
| SMILES | CCCC(=O)c1cc(O)ccc1O.CCCC(=O)c1cc(OC(=O)C2CCC(C(=O)Oc3ccc(O)c(C(=O)CCC)c3)CC2)ccc1O.O=C(Cl)C1CCC(C(=O)Cl)CC1 |
| InChI | InChI=1S/C28H32O8.C10H12O3.C8H10Cl2O2/c1-3-5-23(29)21-15-19(11-13-25(21)31)35-27(33)17-7-9-18(10-8-17)28(34)36-20-12-14-26(32)22(16-20)24(30)6-4-2;1-2-3-9(12)8-6-7(11)4-5-10(8)13;9-7(11)5-1-2-6(4-3-5)8(10)12/h11-18,31-32H,3-10H2,1-2H3;4-6,11,13H,2-3H2,1H3;5-6H,1-4H2 |
| InChIKey | VAKURQJZUMRNKS-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 218.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.83 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|