C21H34O4 — CID 156721369
ethane;2-(2-methylprop-2-enoyloxy)ethyl 5-ethyl-2,3-dimethylbenzoate (PubChem CID 156721369) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is ethane;2-(2-methylprop-2-enoyloxy)ethyl 5-ethyl-2,3-dimethylbenzoate.
| Compound Name | ethane;2-(2-methylprop-2-enoyloxy)ethyl 5-ethyl-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 156721369 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | ethane;2-(2-methylprop-2-enoyloxy)ethyl 5-ethyl-2,3-dimethylbenzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1cc(CC)cc(C)c1C.CC.CC |
| InChI | InChI=1S/C17H22O4.2C2H6/c1-6-14-9-12(4)13(5)15(10-14)17(19)21-8-7-20-16(18)11(2)3;2*1-2/h9-10H,2,6-8H2,1,3-5H3;2*1-2H3 |
| InChIKey | YYRIIEONVPNPSP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|