C17H24N2 — CID 174738393
2-benzyl-1,1-dimethylhydrazine;ethylbenzene (PubChem CID 174738393) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethylhydrazine;ethylbenzene.
| Compound Name | 2-benzyl-1,1-dimethylhydrazine;ethylbenzene |
|---|---|
| PubChem CID | 174738393 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-benzyl-1,1-dimethylhydrazine;ethylbenzene |
| SMILES | CCc1ccccc1.CN(C)NCc1ccccc1 |
| InChI | InChI=1S/C9H14N2.C8H10/c1-11(2)10-8-9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7,10H,8H2,1-2H3;3-7H,2H2,1H3 |
| InChIKey | AVUHONXWHZUVEJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|