About 2-benzyl-1,1-dimethylhydrazine;ethylbenzene
2-benzyl-1,1-dimethylhydrazine;ethylbenzene (PubChem CID 174738393) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethylhydrazine;ethylbenzene.
Molecular Properties
| Compound Name | 2-benzyl-1,1-dimethylhydrazine;ethylbenzene |
| PubChem CID | 174738393 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-benzyl-1,1-dimethylhydrazine;ethylbenzene |
| SMILES | CCc1ccccc1.CN(C)NCc1ccccc1 |
| InChI | InChI=1S/C9H14N2.C8H10/c1-11(2)10-8-9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7,10H,8H2,1-2H3;3-7H,2H2,1H3 |
| InChIKey | AVUHONXWHZUVEJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-1,1-dimethylhydrazine;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,1-dimethylhydrazine;ethylbenzene?
The IUPAC name of 2-benzyl-1,1-dimethylhydrazine;ethylbenzene (CID 174738393) is 2-benzyl-1,1-dimethylhydrazine;ethylbenzene.
What is the SMILES notation for 2-benzyl-1,1-dimethylhydrazine;ethylbenzene?
The canonical SMILES for 2-benzyl-1,1-dimethylhydrazine;ethylbenzene is CCc1ccccc1.CN(C)NCc1ccccc1.
What is the InChIKey of 2-benzyl-1,1-dimethylhydrazine;ethylbenzene?
The InChIKey is AVUHONXWHZUVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.C8H10/c1-11(2)10-8-9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8/h3-7,10H,8H2,1-2H3;3-7H,2H2,1H3.
What are the key properties of 2-benzyl-1,1-dimethylhydrazine;ethylbenzene?
2-benzyl-1,1-dimethylhydrazine;ethylbenzene has a molecular weight of 256.39 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,1-dimethylhydrazine;ethylbenzene is sourced from PubChem (CID 174738393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).