C8H13N3 — CID 21117152
1,1-dimethyl-2-(pyridin-4-ylmethyl)hydrazine (PubChem CID 21117152) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,1-dimethyl-2-(pyridin-4-ylmethyl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(pyridin-4-ylmethyl)hydrazine |
|---|---|
| PubChem CID | 21117152 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1,1-dimethyl-2-(pyridin-4-ylmethyl)hydrazine |
| SMILES | CN(C)NCc1ccncc1 |
| InChI | InChI=1S/C8H13N3/c1-11(2)10-7-8-3-5-9-6-4-8/h3-6,10H,7H2,1-2H3 |
| InChIKey | LQSIPMXVUQECNN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|