C16H19NO3 — CID 159920944
N,N-dimethyl-1-phenylmethanamine;2-hydroxybenzoic acid (PubChem CID 159920944) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;2-hydroxybenzoic acid.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 159920944 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;2-hydroxybenzoic acid |
| SMILES | CN(C)Cc1ccccc1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C9H13N.C7H6O3/c1-10(2)8-9-6-4-3-5-7-9;8-6-4-2-1-3-5(6)7(9)10/h3-7H,8H2,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | NYJPGPSSHZJODF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |