C28H30N2O4 — CID 59121971
1-[5-benzyl-2-methoxy-3-(morpholin-4-ylmethyl)phenyl]-3-(4-methyl-2-pyridinyl)propane-1,3-dione (PubChem CID 59121971) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-[5-benzyl-2-methoxy-3-(morpholin-4-ylmethyl)phenyl]-3-(4-methyl-2-pyridinyl)propane-1,3-dione.
| Compound Name | 1-[5-benzyl-2-methoxy-3-(morpholin-4-ylmethyl)phenyl]-3-(4-methyl-2-pyridinyl)propane-1,3-dione |
|---|---|
| PubChem CID | 59121971 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-[5-benzyl-2-methoxy-3-(morpholin-4-ylmethyl)phenyl]-3-(4-methyl-2-pyridinyl)propane-1,3-dione |
| SMILES | COc1c(CN2CCOCC2)cc(Cc2ccccc2)cc1C(=O)CC(=O)c1cc(C)ccn1 |
| InChI | InChI=1S/C28H30N2O4/c1-20-8-9-29-25(14-20)27(32)18-26(31)24-17-22(15-21-6-4-3-5-7-21)16-23(28(24)33-2)19-30-10-12-34-13-11-30/h3-9,14,16-17H,10-13,15,18-19H2,1-2H3 |
| InChIKey | ZHSUIFBMXMKIEB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|