C13H12O6 — CID 20842227
6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid (PubChem CID 20842227) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid.
| Compound Name | 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid |
|---|---|
| PubChem CID | 20842227 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid |
| SMILES | COc1ccccc1C(=O)CC(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C13H12O6/c1-19-12-5-3-2-4-9(12)10(15)6-8(14)7-11(16)13(17)18/h2-5H,6-7H2,1H3,(H,17,18) |
| InChIKey | LQXNNELHXFSXQV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|