6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid

C13H12O6 — CID 20842227

IUPAC6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid
SMILESCOc1ccccc1C(=O)CC(=O)CC(=O)C(=O)O
InChIInChI=1S/C13H12O6/c1-19-12-5-3-2-4-9(12)10(15)6-8(14)7-11(16)13(17)18/h2-5H,6-7H2,1H3,(H,17,18)
InChIKeyLQXNNELHXFSXQV-UHFFFAOYSA-N
MW264.23 g/mol
LogP0.88
Rot. Bonds7

About 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid

6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid (PubChem CID 20842227) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid.

Molecular Properties

Compound Name6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid
PubChem CID20842227
Molecular FormulaC13H12O6
Molecular Weight264.23 g/mol
Exact Mass264.06
IUPAC Name6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid
SMILESCOc1ccccc1C(=O)CC(=O)CC(=O)C(=O)O
InChIInChI=1S/C13H12O6/c1-19-12-5-3-2-4-9(12)10(15)6-8(14)7-11(16)13(17)18/h2-5H,6-7H2,1H3,(H,17,18)
InChIKeyLQXNNELHXFSXQV-UHFFFAOYSA-N
XLogP0.88
TPSA97.74 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.23
LogP ≤ 50.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid?
The IUPAC name of 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid (CID 20842227) is 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid.
What is the SMILES notation for 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid?
The canonical SMILES for 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid is COc1ccccc1C(=O)CC(=O)CC(=O)C(=O)O.
What is the InChIKey of 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid?
The InChIKey is LQXNNELHXFSXQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O6/c1-19-12-5-3-2-4-9(12)10(15)6-8(14)7-11(16)13(17)18/h2-5H,6-7H2,1H3,(H,17,18).
What are the key properties of 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid?
6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid has a molecular weight of 264.23 g/mol, XLogP of 0.88, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyphenyl)-2,4,6-trioxohexanoic acid is sourced from PubChem (CID 20842227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).