C42H54AlN4O2+ — CID 16688684
bis[2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenoxy]alumanylium (PubChem CID 16688684) has the molecular formula C42H54AlN4O2+ and a molecular weight of 673.90 g/mol. Its IUPAC name is bis[2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenoxy]alumanylium.
| Compound Name | bis[2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenoxy]alumanylium |
|---|---|
| PubChem CID | 16688684 |
| Molecular Formula | C42H54AlN4O2+ |
| Molecular Weight | 673.90 g/mol |
| Exact Mass | 673.41 |
| IUPAC Name | bis[2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenoxy]alumanylium |
| SMILES | CC(C)(C)c1cc(/C=N\c2ccccc2N)c(O[Al+]Oc2c(/C=N/c3ccccc3N)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/2C21H28N2O.Al/c2*1-20(2,3)15-11-14(19(24)16(12-15)21(4,5)6)13-23-18-10-8-7-9-17(18)22;/h2*7-13,24H,22H2,1-6H3;/q;;+3/p-2/b23-13+;23-13-; |
| InChIKey | BXNGZVJQDJTORU-IBEPUFKFSA-L |
| XLogP | 10.53 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.90 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|