C15H21N3O2S2 — CID 95764614
1-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]-3-methylthiourea (PubChem CID 95764614) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is 1-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 95764614 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C(\C)c1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-11(17-18-15(21)16-2)12-7-9-14(10-8-12)22(19,20)13-5-3-4-6-13/h7-10,13H,3-6H2,1-2H3,(H2,16,18,21)/b17-11+ |
| InChIKey | RYFNWLCBBKEYLQ-GZTJUZNOSA-N |
| XLogP | 2.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|