C18H27N3O2S2 — CID 11928021
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(Z)-1-(4-methylsulfonylphenyl)ethylideneamino]thiourea (PubChem CID 11928021) has the molecular formula C18H27N3O2S2 and a molecular weight of 381.57 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(Z)-1-(4-methylsulfonylphenyl)ethylideneamino]thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(Z)-1-(4-methylsulfonylphenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 11928021 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(Z)-1-(4-methylsulfonylphenyl)ethylideneamino]thiourea |
| SMILES | C/C(=N/NC(=S)N[C@H]1CCC[C@@H](C)[C@H]1C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H27N3O2S2/c1-12-6-5-7-17(13(12)2)19-18(24)21-20-14(3)15-8-10-16(11-9-15)25(4,22)23/h8-13,17H,5-7H2,1-4H3,(H2,19,21,24)/b20-14-/t12-,13-,17+/m1/s1 |
| InChIKey | XYTIVYQYNQDQAE-MAQUETAQSA-N |
| XLogP | 3.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|