C17H14N4S2 — CID 134814002
N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-2-amine (PubChem CID 134814002) has the molecular formula C17H14N4S2 and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134814002 |
| Molecular Formula | C17H14N4S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-1,3-thiazol-2-amine |
| SMILES | CC(=NNc1nccs1)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C17H14N4S2/c1-11(20-21-17-18-8-9-22-17)12-6-7-16-14(10-12)19-13-4-2-3-5-15(13)23-16/h2-10,19H,1H3,(H,18,21) |
| InChIKey | RDOCYSBZQOFTEN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|