C21H14F3N5O4S — CID 4598117
2,6-dinitro-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 4598117) has the molecular formula C21H14F3N5O4S and a molecular weight of 489.44 g/mol. Its IUPAC name is 2,6-dinitro-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-dinitro-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 4598117 |
| Molecular Formula | C21H14F3N5O4S |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 2,6-dinitro-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | CC(=NNc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C21H14F3N5O4S/c1-11(12-6-7-19-15(8-12)25-14-4-2-3-5-18(14)34-19)26-27-20-16(28(30)31)9-13(21(22,23)24)10-17(20)29(32)33/h2-10,25,27H,1H3 |
| InChIKey | HURXZGRTEFRMHT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|