C17H11F3N4O5 — CID 6296979
N-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 6296979) has the molecular formula C17H11F3N4O5 and a molecular weight of 408.29 g/mol. Its IUPAC name is N-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 6296979 |
| Molecular Formula | C17H11F3N4O5 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-[(Z)-1-(1-benzofuran-2-yl)ethylideneamino]-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | C/C(=N/Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H11F3N4O5/c1-9(15-6-10-4-2-3-5-14(10)29-15)21-22-16-12(23(25)26)7-11(17(18,19)20)8-13(16)24(27)28/h2-8,22H,1H3/b21-9- |
| InChIKey | PLWPFDMJRLXBMD-NKVSQWTQSA-N |
| XLogP | 5.10 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|