C12H9F3O — CID 134858852
2-[(E)-4,4,4-trifluorobut-2-en-2-yl]-1-benzofuran (PubChem CID 134858852) has the molecular formula C12H9F3O and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-[(E)-4,4,4-trifluorobut-2-en-2-yl]-1-benzofuran.
| Compound Name | 2-[(E)-4,4,4-trifluorobut-2-en-2-yl]-1-benzofuran |
|---|---|
| PubChem CID | 134858852 |
| Molecular Formula | C12H9F3O |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-[(E)-4,4,4-trifluorobut-2-en-2-yl]-1-benzofuran |
| SMILES | C/C(=C\C(F)(F)F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C12H9F3O/c1-8(7-12(13,14)15)11-6-9-4-2-3-5-10(9)16-11/h2-7H,1H3/b8-7+ |
| InChIKey | ZBOJBBCTYAZOMI-BQYQJAHWSA-N |
| XLogP | 4.40 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |