C16H16ClN3O3S — CID 55779661
(4-chloro-3,5-dimethylphenyl) 2-[2-(2-oxoimidazolidin-1-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 55779661) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 2-[2-(2-oxoimidazolidin-1-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 2-[2-(2-oxoimidazolidin-1-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 55779661 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 2-[2-(2-oxoimidazolidin-1-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1cc(OC(=O)Cc2csc(N3CCNC3=O)n2)cc(C)c1Cl |
| InChI | InChI=1S/C16H16ClN3O3S/c1-9-5-12(6-10(2)14(9)17)23-13(21)7-11-8-24-16(19-11)20-4-3-18-15(20)22/h5-6,8H,3-4,7H2,1-2H3,(H,18,22) |
| InChIKey | WWRPMFBFUJRKBL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|