C12H18N2O2S2 — CID 83206503
N-cyclopentyloxy-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetamide (PubChem CID 83206503) has the molecular formula C12H18N2O2S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-cyclopentyloxy-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetamide.
| Compound Name | N-cyclopentyloxy-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 83206503 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-cyclopentyloxy-2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetamide |
| SMILES | Cc1nc(CSCC(=O)NOC2CCCC2)cs1 |
| InChI | InChI=1S/C12H18N2O2S2/c1-9-13-10(7-18-9)6-17-8-12(15)14-16-11-4-2-3-5-11/h7,11H,2-6,8H2,1H3,(H,14,15) |
| InChIKey | ICUXPGVRGXKERB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|