About [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate (PubChem CID 9475402) has the molecular formula C15H21N3O4S2
and a molecular weight of 371.48 g/mol. Its IUPAC name is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate.
Molecular Properties
| Compound Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate |
| PubChem CID | 9475402 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate |
| SMILES | Cc1nc(CSCC(=O)OCC(=O)N2CCC(C(N)=O)CC2)cs1 |
| InChI | InChI=1S/C15H21N3O4S2/c1-10-17-12(8-24-10)7-23-9-14(20)22-6-13(19)18-4-2-11(3-5-18)15(16)21/h8,11H,2-7,9H2,1H3,(H2,16,21) |
| InChIKey | XCWWMYUWQFGSSA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate?
The IUPAC name of [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate (CID 9475402) is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate.
What is the SMILES notation for [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate?
The canonical SMILES for [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate is Cc1nc(CSCC(=O)OCC(=O)N2CCC(C(N)=O)CC2)cs1.
What is the InChIKey of [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate?
The InChIKey is XCWWMYUWQFGSSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O4S2/c1-10-17-12(8-24-10)7-23-9-14(20)22-6-13(19)18-4-2-11(3-5-18)15(16)21/h8,11H,2-7,9H2,1H3,(H2,16,21).
What are the key properties of [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate?
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate has a molecular weight of 371.48 g/mol, XLogP of 0.95, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate is sourced from PubChem (CID 9475402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).