C11H13N3O2S2 — CID 62188952
methyl 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate (PubChem CID 62188952) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is methyl 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate.
| Compound Name | methyl 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 62188952 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | methyl 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-16-9(15)3-4-17-6-8-13-10(12)7-2-5-18-11(7)14-8/h2,5H,3-4,6H2,1H3,(H2,12,13,14) |
| InChIKey | IABOYILWKCYPDR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|